(S)-7-Methoxy-3,7-dimethyloctanal is a flavor and fragrance ingredient that has been identified in Houttuynia cordata, a plant used in traditional contexts. Its chiral structure contributes to its olfactory properties.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 134678-53-8
(3S)-7-methoxy-3,7-dimethyloctanal
IDWULKZGRNHZNR-JTQLQIEISA-N
C[C@@H](CCCC(C)(C)OC)CC=O