L-Alanine tert-butyl ester hydrochloride is a protected form of the amino acid L-alanine, where the carboxyl group is masked as a tert-butyl ester and the amino group is present as the hydrochloride salt. It is primarily used as a building block in peptide synthesis and as a research reagent for studying amino acid chemistry and protein modifications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
L-Alanine tert-butyl ester hydrochloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Tert-Butyl-d9-amine Hydrochloride
deuterated amine research compound
Sodium 2-glycerophosphate pentahydrate
certified reference standard
(4-propylphenyl)boronic Acid
Boronic acid reagent for organic synthesis
1-Amino-11-azido-3,6,9-trioxaundecane
PEG linker for bioconjugation
D-Alanine tert-butyl ester hydrochloride
research compound
L-Alanine tert-butyl ester hydrochloride(CAS 13404-22-3)의 국제 HS 코드는 2922.49입니다.
2922.49
2922 49 85
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
tert-butyl (2S)-2-aminopropanoate;hydrochloride
WIQIWPPQGWGVHD-JEDNCBNOSA-N
C[C@@H](C(=O)OC(C)(C)C)N.Cl
L-Alanine tert-butyl ester hydrochloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.