L-Alanine tert-butyl ester hydrochloride is a protected form of the amino acid L-alanine, where the carboxyl group is masked as a tert-butyl ester and the amino group is present as the hydrochloride salt. It is primarily used as a building block in peptide synthesis and as a research reagent for studying amino acid chemistry and protein modifications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 13404-22-3
Tert-Butyl-d9-amine Hydrochloride
deuterated amine research compound
Sodium 2-glycerophosphate pentahydrate
certified reference standard
(4-propylphenyl)boronic Acid
Boronic acid reagent for organic synthesis
1-Amino-11-azido-3,6,9-trioxaundecane
PEG linker for bioconjugation
D-Alanine tert-butyl ester hydrochloride
research compound
tert-butyl (2S)-2-aminopropanoate;hydrochloride
WIQIWPPQGWGVHD-JEDNCBNOSA-N
C[C@@H](C(=O)OC(C)(C)C)N.Cl