Aristolactam I is a metabolite of aristolochic acid, a natural compound found in Aristolochia species such as Aristolochia kankauensis and Aristolochia debilis. It is primarily known for its role in forming DNA adducts and is studied in the context of pharmaceutical impurity research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Aristolactam I 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
14-methoxy-3,5-dioxa-10-azapentacyclo[9.7.1.02,6.08,19.013,18]nonadeca-1(18),2(6),7,11(19),12,14,16-heptaen-9-one
MXOKGWUJNGEKBH-UHFFFAOYSA-N
COC1=CC=CC2=C3C4=C(C=C21)NC(=O)C4=CC5=C3OCO5
Aristolactam I 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.