Trityllosartan is a chemical compound used as a pharmaceutical intermediate, specifically in the synthesis of the antihypertensive drug losartan. Its structure features a tetrazole ring with a trityl protecting group, which is characteristic of intermediates used in sartan-class drug manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 133909-99-6
(2-BUTYL-4-CHLORO-1-((2'-(1-TRITYL-1H-TETRAAZOL-5-YL)(1,1'-BIPHENYL)-4-YL)METHYL)-1H-IMIDAZOL-5-YL)METHANOL
pharmaceutical impurity standard
Alogliptin Impurity 70
pharmaceutical intermediate for alogliptin
8-Hydroxyquinoline sulfate
chelating agent for metal ions
4-Chlorobenzhydryl chloride
Pharmaceutical intermediate for synthesis
4-CHLOROBENZOPHENONE
pharmaceutical intermediate
N-Trityl Olmesartan Ethyl Ester
pharmaceutical intermediate
[2-butyl-5-chloro-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanol
QQPGGBNMTNDKEY-UHFFFAOYSA-N
CCCCC1=NC(=C(N1CC2=CC=C(C=C2)C3=CC=CC=C3C4=NN(N=N4)C(C5=CC=CC=C5)(C6=CC=CC=C6)C7=CC=CC=C7)CO)Cl