1,2-dicervonoylglycerol is a long-chain diglyceride used as a research standard in lipid studies. Its structure features two docosahexaenoic acid chains esterified to a glycerol backbone, contributing to its high molecular weight and flexibility.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1,2-dicervonoylglycerol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1,2,3,4-Tetrahydro-1,5-naphthyridine hydrochloride
research compound
2-Cyanoethyl (6-(2,2,2-trifluoroacetamido)hexyl) diisopropylphosphoramidite
solid-phase oligonucleotide synthesis reagent
2-oxaspiro[3.3]heptan-6-one
research reagent
BENZIL
organic synthesis reagent
[2-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxy-3-hydroxypropyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate
XIAZEYRSKHAPND-GZSOIYOPSA-N
CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OCC(CO)OC(=O)CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC
1,2-dicervonoylglycerol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.