3,5-Dimethylbenzoic-d9 Acid is a deuterated research standard. It is a benzoic acid derivative with nine deuterium atoms replacing hydrogen atoms on the methyl groups and the aromatic ring.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3,5-Dimethylbenzoic-d9 Acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Bis(2-(2,4-difluorobenzene-6-id-1-yl)-5-methylpyridine);iridium(3+);2-pyridin-2-ylpyridine;hexafluorophosphate
iridium complex for research
REL-(1R,3R,5S)-BICYCLO[3.1.0]HEXAN-3-YL METHANESULFONATE
research compound
AG 555
EGF receptor kinase inhibitor
Tyrphostin AG 835
tyrosine kinase inhibitor research reagent
3,5-DIMETHYLBENZOIC ACID
chemical intermediate for synthesis
2,4,6-trideuterio-3,5-bis(trideuteriomethyl)benzoic acid
UMVOQQDNEYOJOK-XVGWXEQOSA-N
[2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])C([2H])([2H])[2H])[2H])C(=O)O
3,5-Dimethylbenzoic-d9 Acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.