Aflatoxin M1-d3 is an isotopically labeled analytical reference standard used for the detection and quantification of aflatoxin M1, a mycotoxin found in milk and dairy products. The compound features deuterium atoms that enable precise mass spectrometric analysis in laboratory settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1330042-13-1
Aflatoxin M2-d3
Deuterated mycotoxin research standard
1-(4-Ethoxycarbonylphenyl)piperazine-d8
Deuterated research compound
Methyl 3,6-dibromopyrazine-2-carboxylate
research compound
Sulfadoxine-d4 (benzene-d4)
Deuterated research standard
4-Bromo-3-fluorobenzaldehyde
research compound
Aflatoxin M1-13C17
isotopically labeled analytical reference standard
AFLATOXIN M1
mycotoxin reference standard
(3R,7R)-3-hydroxy-11-(trideuteriomethoxy)-6,8,19-trioxapentacyclo[10.7.0.02,9.03,7.013,17]nonadeca-1,4,9,11,13(17)-pentaene-16,18-dione
MJBWDEQAUQTVKK-MVOYJBSWSA-N
[2H]C([2H])([2H])OC1=C2C3=C(C(=O)CC3)C(=O)OC2=C4C(=C1)O[C@@H]5[C@]4(C=CO5)O