N-epsilon-t-Butyloxycarbonyl-L-lysine t-butyl ester hydrochloride is a protected lysine derivative commonly used as a pharmaceutical intermediate. Its structure features an amino group and two ester moieties, reflecting its role in peptide synthesis and drug manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
H-Lys(Boc)-OMe.HCl
Protected lysine derivative for peptide synthesis
(S)-1-Boc-3-methanesulfonyloxy-pyrrolidine
Pharmaceutical intermediate for pyrrolidine derivatives
(R)-1-Boc-3-cyanopyrrolidine
pharmaceutical intermediate
(S)-1-Boc-3-cyanopyrrolidine
pharmaceutical intermediate
D-Ribofuranose, 1-acetate
nucleoside synthesis intermediate
tert-butyl (2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate;hydrochloride
TZBPQINFXPIRBX-MERQFXBCSA-N
CC(C)(C)OC(=O)[C@H](CCCCNC(=O)OC(C)(C)C)N.Cl
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.