2,6-Dichloropurine riboside is a purine nucleoside analog consisting of a ribose sugar moiety and a 2,6-dichloropurine base. It serves as a key building block in the synthesis of various nucleoside analogue pharmaceuticals.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 13276-52-3
2-Chloroadenosine
adenosine receptor agonist
2-Amino-6-chloropurine riboside
pharmaceutical intermediate for nucleotide synthesis
2-Chloro-9-pentofuranosyl-9H-purin-6-amine--water (1/1)
Nucleoside analog research reagent
Ethyl (4-(3-oxomorpholino)phenyl)carbamate
pharmaceutical intermediate
2-((3-Chlorophenyl)amino)benzoic acid
pharmaceutical intermediate
4-Chloro-2,5-difluorobenzoic acid
Pharmaceutical intermediate
2-Chloro-4-(4-fluorophenyl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine
pharmaceutical intermediate
(2R,3R,4S,5R)-2-(2,6-dichloropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol
HJXWZGVMHDPCRS-UUOKFMHZSA-N
C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N=C(N=C2Cl)Cl