Boc-D-Dap(Fmoc)(Fmoc)-OH is a protected amino acid derivative used as an intermediate in solid-phase peptide synthesis. Its orthogonal protecting groups—a tert-butoxycarbonyl (Boc) on the alpha amine and two 9-fluorenylmethoxycarbonyl (Fmoc) groups on the side chain—enable selective deprotection during the assembly of complex peptides.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Fmoc-L-cysteine
peptide synthesis intermediate
(2S)-2-{[(tert-butoxy)carbonyl]amino}-5-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanoic acid
peptide synthesis intermediate
(2S)-4-{[(tert-butoxy)carbonyl]amino}-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanoic acid
peptide synthesis intermediate
TERT-BUTYL N-[(1S)-1-(BENZYLCARBAMOYL)-2-HYDROXYETHYL]CARBAMATE
peptide synthesis intermediate
Betulin aldehyde
Triterpenoid pharmaceutical intermediate
N-Vinylformamide
pharmaceutical intermediate
Butanedioic acid, 2,3-dihydroxy-, dimethyl ester, (2S,3S)-
chiral pharmaceutical intermediate
BENZYL (3-BROMO-2-OXOPROPYL)CARBAMATE
pharmaceutical intermediate
(2R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid
MVWPBNQGEGBGRF-LJQANCHMSA-N
CC(C)(C)OC(=O)N[C@H](CNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)C(=O)O
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.