5-Acetylsalicylic acid is a chemical compound that serves as a pharmaceutical intermediate, specifically used in the production of acetylsalicylic acid (aspirin) and as a reference impurity standard for quality control in pharmaceutical manufacturing. It is a derivative of salicylic acid, a naturally occurring plant hormone originally derived from willow bark.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 13110-96-8
4-Hydroxyisophthalic acid
chemical intermediate for synthesis
(2-Aminothiazol-5-yl)methanol
Pharmaceutical intermediate
8-BROMO-5,6-DIFLUORO-2-METHYLQUINOLINE
pharmaceutical intermediate
Tert-butyl 4-(chloromethyl)-4-(hydroxymethyl)piperidine-1-carboxylate
Pharmaceutical intermediate for piperidine derivatives
TERT-BUTYL 6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)NAPHTHALEN-2-YLCARBAMATE
Pharmaceutical intermediate for API synthesis
5-acetyl-2-hydroxybenzoic acid
NZRDKNBIPVLNHA-UHFFFAOYSA-N
CC(=O)C1=CC(=C(C=C1)O)C(=O)O