Spiroalmotriptan is a spirocyclic indoline derivative featuring a pyrrolidine sulfonylmethyl substituent. It is characterized by a complex fused-ring structure that includes an alcohol functional group and multiple heterocyclic rings, with a molecular weight of approximately 351 Da, moderate lipophilicity, and two hydrogen bond donors.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1309457-18-8
1'-methyl-5-(pyrrolidin-1-ylsulfonylmethyl)spiro[1,2-dihydroindole-3,3'-pyrrolidine]-2-ol
LXSWXVHNXSOIPG-UHFFFAOYSA-N
CN1CCC2(C1)C(NC3=C2C=C(C=C3)CS(=O)(=O)N4CCCC4)O