This compound is the benzyl ester derivative of L-glutamic acid. It is primarily used as an intermediate in peptide synthesis, particularly in the construction of glutamate-containing peptides.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 13030-09-6
Fmoc-3-Ala(2-thienyl)-OH
Peptide synthesis building block
4-(Boc-amino)cyclohexanecarboxylic Acid
pharmaceutical intermediate
1-(3,5-dichlorophenyl)-2,2,2-trifluoroethanone
Pharmaceutical intermediate
(1R,2S)-2-Fluorocyclopropane-1-carboxylic acid
pharmaceutical intermediate
(4S)-4-amino-5-oxo-5-phenylmethoxypentanoic acid
HFZKKJHBHCZXTQ-JTQLQIEISA-N
C1=CC=C(C=C1)COC(=O)[C@H](CCC(=O)O)N