Cetrorelix diacetate is a synthetic peptide compound used as an active pharmaceutical ingredient. It is a salt form of cetrorelix, a gonadotropin-releasing hormone (GnRH) antagonist, and is characterized by its complex structure with multiple amino acid residues and acetate counterions.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Cetrorelix diacetate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Cetrorelix acetate
gonadotropin-releasing hormone antagonist
Cetrorelix
active pharmaceutical ingredient
Ganirelix
gonadotropin-releasing hormone antagonist
Ganirelix
gonadotropin-releasing hormone antagonist
Risperidone Pyrimidinone-N-oxide
pharmaceutical reference standard impurity
Latanoprost
antiglaucoma active pharmaceutical ingredient
Bimatoprost isopropyl ester
prostaglandin analog ophthalmic agent
Icatibant
active pharmaceutical ingredient
(2S)-1-[(2S)-2-[[(2S)-2-[[(2R)-2-[[(2S)-2-[[(2S)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-acetamido-3-naphthalen-2-ylpropanoyl]amino]-3-(4-chlorophenyl)propanoyl]amino]-3-pyridin-3-ylpropanoyl]amino]-3-hydroxypropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-N-[(2R)-1-amino-1-oxopropan-2-yl]pyrrolidine-2-carboxamide;acetic acid
DTPVYWHLQLAXFT-SMCUOGPFSA-N
C[C@H](C(=O)N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CCCNC(=O)N)NC(=O)[C@H](CC2=CC=C(C=C2)O)NC(=O)[C@H](CO)NC(=O)[C@@H](CC3=CN=CC=C3)NC(=O)[C@@H](CC4=CC=C(C=C4)Cl)NC(=O)[C@@H](CC5=CC6=CC=CC=C6C=C5)NC(=O)C.CC(=O)O.CC(=O)O
Cetrorelix diacetate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.