This compound is a chiral piperazine derivative with a tert-butyl ester protecting group. It is primarily used as a building block in the synthesis of more complex molecules for pharmaceutical research and development.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Tert-butyl (3R,5S)-3,5-dimethylpiperazine-1-carboxylate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Ethyl Piperazine-2-carboxylate Dihydrochloride
Pharmaceutical intermediate
1-tert-butyl 3-methyl piperazine-1,3-dicarboxylate
pharmaceutical intermediate
1-(1,1-Dimethylethyl) 2-methyl 1,2-piperazinedicarboxylate
pharmaceutical intermediate for synthesis
(1r,2s,3s,4r,5s)-1-(acetoxymethyl)-5-(4-chloro-3-(4-ethoxybenzyl)phenyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triyl triacetate
pharmaceutical intermediate
tert-butyl (3R,5S)-3,5-dimethylpiperazine-1-carboxylate
NUZXPHIQZUYMOR-DTORHVGOSA-N
C[C@@H]1CN(C[C@@H](N1)C)C(=O)OC(C)(C)C
Tert-butyl (3R,5S)-3,5-dimethylpiperazine-1-carboxylate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.