Ganirelix acetate is a synthetic decapeptide compound that acts as a competitive antagonist of gonadotropin-releasing hormone (GnRH). It rapidly suppresses the pituitary secretion of luteinizing hormone (LH) and follicle-stimulating hormone (FSH), and is used as a pharmaceutical raw material in assisted reproduction protocols to control ovulation.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Ganirelix acetate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Ganirelix
gonadotropin-releasing hormone antagonist
Ganirelix
gonadotropin-releasing hormone antagonist
Cetrorelix acetate
gonadotropin-releasing hormone antagonist
Antide
gonadotropin-releasing hormone antagonist
Abarelix
gonadotropin-releasing hormone antagonist
Elagolix sodium
gonadotropin-releasing hormone antagonist
Linzagolix
gonadotropin-releasing hormone antagonist
Monosodium alendronate
active pharmaceutical ingredient
(2S)-1-[(2S)-2-[[(2S)-2-[[(2R)-2-[[(2S)-2-[[(2S)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-acetamido-3-naphthalen-2-ylpropanoyl]amino]-3-(4-chlorophenyl)propanoyl]amino]-3-pyridin-3-ylpropanoyl]amino]-3-hydroxypropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-6-[bis(ethylamino)methylideneamino]hexanoyl]amino]-4-methylpentanoyl]amino]-6-[bis(ethylamino)methylideneamino]hexanoyl]-N-[(2R)-1-amino-1-oxopropan-2-yl]pyrrolidine-2-carboxamide;acetic acid
OVBICQMTCPFEBS-SATRDZAXSA-N
CCNC(=NCCCC[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN=C(NCC)NCC)C(=O)N1CCC[C@H]1C(=O)N[C@H](C)C(=O)N)NC(=O)[C@H](CC2=CC=C(C=C2)O)NC(=O)[C@H](CO)NC(=O)[C@@H](CC3=CN=CC=C3)NC(=O)[C@@H](CC4=CC=C(C=C4)Cl)NC(=O)[C@@H](CC5=CC6=CC=CC=C6C=C5)NC(=O)C)NCC.CC(=O)O.CC(=O)O
Ganirelix acetate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.