Ac-D-2Nal-D-Phe(4-Cl)-D-3Pal-OH is a synthetic peptide compound consisting of three D-amino acid residues with an acetylated N-terminus. It is used as a research reagent in laboratory settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 129225-22-5
(3R,8S,9S,12R)-Atazanavir
reference standard impurity
5,8-DIOXA-10-AZADISPIRO[2.0.4.3]UNDECANE
Research reagent for heterocyclic chemistry
5-methoxy-2-(2H-1,2,3-triazol-2-yl)benzoic acid
research compound
2-chloro-5,6,7,8-tetrahydroquinolin-8-one
research compound
(2R)-2-[[(2R)-2-[[(2R)-2-acetamido-3-naphthalen-2-ylpropanoyl]amino]-3-(4-chlorophenyl)propanoyl]amino]-3-pyridin-3-ylpropanoic acid
UELARIGGXWXYRN-MPFGFTFXSA-N
CC(=O)N[C@H](CC1=CC2=CC=CC=C2C=C1)C(=O)N[C@H](CC3=CC=C(C=C3)Cl)C(=O)N[C@H](CC4=CN=CC=C4)C(=O)O