1,5-Diaminoanthraquinone is an organic compound primarily used as an intermediate in the production of disperse dyes. It features two amino groups attached to an anthraquinone core, contributing to its role in dye chemistry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 129-44-2
1-AMINOANTHRAQUINONE
dye and pigment intermediate
1,8-DIAMINOANTHRAQUINONE
dye intermediate
Chromotropic acid disodium salt
Mordant dye and analytical reagent
Sodium naphthionate
naphthalene sulfonate dye intermediate
Dehydrothio-p-toluidinesulfonic acid
Intermediate for azo dyes
1,7-Naphthalenedisulfonic acid, 4-amino-5-hydroxy-
intermediate for dye production
1,5-diaminoanthracene-9,10-dione
VWBVCOPVKXNMMZ-UHFFFAOYSA-N
C1=CC2=C(C(=C1)N)C(=O)C3=C(C2=O)C(=CC=C3)N