This compound is a protected D-serine derivative used as a building block in solid-phase peptide synthesis. The Fmoc group protects the amine, while the tert-butyl group protects the side-chain hydroxyl, enabling selective deprotection during chain assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
9-fluorenylmethyloxycarbonyl-D-Ser(t-butyl)-OH 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Fmoc-Ser(tBu)-Gly-OH
protected dipeptide building block
Fmoc-beta-t-butyl-L-alanine
peptide synthesis building block
4-tert-Butyl N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-aspartate
Peptide synthesis intermediate
Fmoc-3-Ala(2-thienyl)-OH
Peptide synthesis building block
(2R,3S)-3-(tert-butoxy)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanoic acid
Peptide synthesis building block
Fmoc-Cys(pMeOBzl)-OH
Peptide synthesis building block
(2R)-2-{[(9H-FLUOREN-9-YLMETHOXY)CARBONYL]AMINO}-4-METHYLPENTANOIC ACID
Peptide synthesis building block
Benzyl 3-hydroxyazetidine-1-carboxylate
pharmaceutical intermediate
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]propanoic acid
REITVGIIZHFVGU-LJQANCHMSA-N
CC(C)(C)OC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
9-fluorenylmethyloxycarbonyl-D-Ser(t-butyl)-OH 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.