2-Nitrofluorene-d9 is a deuterated research standard, specifically a nonadeuterio-labeled derivative of 7-nitrofluorene. Its primary significance lies in its use as an isotopically labeled reference compound for analytical and research applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 128008-87-7
2-Bromonicotinaldehyde
research compound
4-Bromo-2-fluoropyridine
research reagent
3-(Dimethylamino)propyl chloride hydrochloride
research intermediate for organic synthesis
2'-OMe PAC Abeta-cyanoethyl phosphoramidite
Oligonucleotide synthesis phosphoramidite building block
1,2,3,4,5,6,8,9,9-nonadeuterio-7-nitrofluorene
XFOHWECQTFIEIX-MFNUZUOVSA-N
[2H]C1=C(C(=C2C(=C1[2H])C3=C(C2([2H])[2H])C(=C(C(=C3[2H])[2H])[N+](=O)[O-])[2H])[2H])[2H]