4,4'-Dinitro-2,2'-stilbenedisulfonic acid is an arenesulfonic acid primarily used as an intermediate in the synthesis of azo dyes.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 128-42-7
4-Nitro-4'-aminostilbene-2,2'-disulfonic acid
stilbene dye intermediate
Dehydrothio-p-toluidinesulfonic acid
Intermediate for azo dyes
5-Amino-2-naphthalenesulfonic acid
Intermediate for azo dyes
2,5-Diaminobenzenesulfonic acid
Intermediate for azo dyes
16,17-Dihydroxyviolanthrone
vat dye intermediate
3,4,9,10-Perylenetetracarboxylic dianhydride
Perylene pigment intermediate
Cyanine Green G Base
solvent dye for waxes and plastics
9,10-Anthracenedione, 1-bromo-4-(methylamino)-
anthraquinone dye intermediate
5-nitro-2-[(E)-2-(4-nitro-2-sulfophenyl)ethenyl]benzenesulfonic acid
UETHPMGVZHBAFB-OWOJBTEDSA-N
C1=CC(=C(C=C1[N+](=O)[O-])S(=O)(=O)O)/C=C/C2=C(C=C(C=C2)[N+](=O)[O-])S(=O)(=O)O