This compound is a chiral beta-lactone derivative used as a pharmaceutical intermediate. Its primary significance is in the synthesis of beta-lactone-containing molecules, which are important building blocks for various pharmaceuticals.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(R)-tert-Butyl (2-oxooxetan-3-yl)carbamate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(R)-Piperazine-2-carboxylic acid dihydrochloride
pharmaceutical intermediate
Trans-N4-[(1R)-2-methoxy-1-methyl-ethyl]cyclohexane-1,4-diamine
Pharmaceutical intermediate
1-Benzyl 2-ethyl piperidine-1,2-dicarboxylate
Pharmaceutical intermediate for peptide synthesis
(1S,2R)-1-amino-2,3-dihydro-1H-inden-2-ol
pharmaceutical intermediate
N-(tert-Butoxycarbonyl)-L-serine beta-Lactone
Pharmaceutical intermediate for peptide synthesis
오를리스타트
antiobesity agent
Lipstatin
pancreatic lipase inhibitor
(3S,4S)-3-Hexyl-4-((R)-2-hydroxytridecyl)-2-oxetanone
Orlistat USP reference standard
tert-butyl N-[(3R)-2-oxooxetan-3-yl]carbamate
HRJDEHQWXAPGBG-RXMQYKEDSA-N
CC(C)(C)OC(=O)N[C@@H]1COC1=O
(R)-tert-Butyl (2-oxooxetan-3-yl)carbamate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.