This compound is a carbamate derivative featuring a fluorenylmethyl group and a piperidine ring with defined stereochemistry. It is primarily used as a research reagent in laboratory settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1263046-53-2
(9H-Fluoren-9-yl)methyl (S)-pyrrolidin-3-ylcarbamate
research reagent
(R)-3-(Fmoc-amino)pyrrolidine HCl
Chiral building block for pharma synthesis
17-Desacetyl Norgestimate-d6 (Major)
deuterated analytical reference standard
2-Amino-3-bromo-6-methylpyridine
research compound
3-AMINO-2-BROMO-4-METHYLPYRIDINE
Research reagent for chemical synthesis
(2,3-difluoropyridin-4-yl)boronic acid
research compound
(9H-Fluoren-9-yl)methyl piperidin-3-ylcarbamate--hydrogen chloride (1/1)
Fmoc-protected piperidine intermediate
9H-fluoren-9-ylmethyl N-[(3R)-piperidin-3-yl]carbamate
GYWRUVMYLXECOL-CQSZACIVSA-N
C1C[C@H](CNC1)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24