4-Bromo-3-nitropyridine hydrochloride is a chemical compound featuring a pyridine ring substituted with bromine and nitro groups, typically supplied as a hydrochloride salt. It is primarily used as a research chemical intermediate in organic synthesis and laboratory-scale reactions.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1260816-42-9
(+)-O-DesMethyl TraMadol-D6
Deuterated analytical reference standard
Rac N,O-Didesmethyl Tramadol-d3
deuterated analytical reference standard
4-Chloro-3-iodo-2-methoxypyridine
research compound
2-(2-Amino-3-hydroxy-2-(hydroxymethyl)propoxy)-1-hydroxypropyl)phosphonic acid
Research reagent
4-bromo-3-nitropyridine;hydrochloride
OEUXXJASPJSLDW-UHFFFAOYSA-N
C1=CN=CC(=C1Br)[N+](=O)[O-].Cl