Atorvastatin Acetonide tert-Butyl Ester is a chemical compound used as an intermediate in the manufacturing of atorvastatin, a statin medication. It features a complex structure incorporating a pyrrole ring, acetonide protecting group, and tert-butyl ester moiety.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 125971-95-1
2-(2-(4-fluorophenyl)-2-oxo-1-phenylethyl)-4-methyl-3-oxo-N-phenylpentanamide
pharmaceutical intermediate
(4R,6R)-tert-Butyl-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxane-4-acetate
Atorvastatin Intermediate
Di-tert-butyl (R)-4-oxopyrrolidine-1,2-dicarboxylate
Pharmaceutical intermediate for synthesis
(R)-2-AMINO-4-(NAPHTHALEN-1-YL)BUTANOIC ACID
Pharmaceutical intermediate for agomelatine impurities
tert-butyl 2-[(4R,6R)-6-[2-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]ethyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate
NPPZOMYSGNZDKY-ROJLCIKYSA-N
CC(C)C1=C(C(=C(N1CC[C@@H]2C[C@@H](OC(O2)(C)C)CC(=O)OC(C)(C)C)C3=CC=C(C=C3)F)C4=CC=CC=C4)C(=O)NC5=CC=CC=C5