This compound is a piperidine-based carboxylic acid derivative featuring a tert-butoxycarbonyl (Boc) protecting group and a hydroxyl substituent. It serves as a pharmaceutical intermediate primarily utilized in the synthesis of drug candidates.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1251032-53-7
Ticagrelor metabolite M5
pharmaceutical metabolite impurity standard
(2S)-4-{[(tert-butoxy)carbonyl]amino}-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanoic acid
peptide synthesis intermediate
Tert-butyl (S)-(1-(4-ethoxyphenyl)-3-hydroxypropan-2-yl)carbamate
Boc-protected amino alcohol intermediate
(R)-NODAGA-tris(t-Bu ester)
chelating agent intermediate for bioconjugation
2-[4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-2-methylpropanoic acid
NUJXHFXAZXQBFA-UHFFFAOYSA-N
CC(C)(C)OC(=O)N1CCC(CC1)(C(C)(C)C(=O)O)O
—