4-Aminocyclohexanol-d10 is a deuterated research compound where all hydrogen atoms on the cyclohexane ring are replaced by deuterium, incorporating both an amino and a hydroxyl functional group. It is primarily used as an analytical standard or labeled reagent in chemical and biological research to study metabolic pathways or reaction mechanisms.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1241045-80-6
MMP-inhibitor I
matrix metalloproteinase inhibitor
Enzalutamide metabolite M5
research compound
Methyl 5-bromo-3-hydroxypicolinate
research chemical intermediate
5-Trifluoromethyl-pyridine-2-carboxylic acid methyl ester
research compound
4-Aminocyclohexanol
research compound for testicular atrophy studies
(1s,4s)-4-aminocyclohexan-1-ol hydrochloride
intermediate for ambroxol impurity synthesis
(1s,4s)-4-aminocyclohexan-1-ol hydrochloride
pharmaceutical intermediate
4-amino-1,2,2,3,3,4,5,5,6,6-decadeuteriocyclohexan-1-ol
IMLXLGZJLAOKJN-MBXGXEIXSA-N
[2H]C1(C(C(C(C(C1([2H])N)([2H])[2H])([2H])[2H])([2H])O)([2H])[2H])[2H]