2,4-difluoro-5-nitroaniline is a fluorinated aromatic amine compound used as a pharmaceutical intermediate. Its structure features an aromatic ring substituted with two fluorine atoms, a nitro group, and an amino group, contributing to its utility in chemical synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 123344-02-5
2-Bromo-7-iodo-9H-fluorene
pharmaceutical intermediate
Tert-butyl N-methyl-N-(2-oxoethyl)carbamate
Pharmaceutical intermediate for peptide synthesis
5-broMo-4-chlorothiophene-2-carboxylic acid
pharmaceutical intermediate
(S)-3-(METHYLSULFONYL)PIPERIDINE
pharmaceutical intermediate
2,4-difluoro-5-nitroaniline
LYWNQLCSOFZLOR-UHFFFAOYSA-N
C1=C(C(=CC(=C1[N+](=O)[O-])F)F)N