Pymetrozine is an insecticide in the pyridine-azomethine chemical class, used primarily to control homopteran pests such as aphids and whiteflies in agriculture. It acts by selectively targeting the nervous system of sap-feeding insects, causing them to stop feeding soon after ingestion, which minimizes harm to non-target beneficial insects.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 123312-89-0
6-methyl-4-[(E)-pyridin-3-ylmethylideneamino]-2,5-dihydro-1,2,4-triazin-3-one
QHMTXANCGGJZRX-WUXMJOGZSA-N
CC1=NNC(=O)N(C1)/N=C/C2=CN=CC=C2