This compound is a pharmaceutical intermediate related to bendamustine, featuring a complex structure with multiple aromatic rings, amine groups, and halogen atoms. It is primarily used in research and manufacturing settings as a reference standard or building block for bendamustine-related compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1228551-91-4
Bendamustine
alkylating antineoplastic active pharmaceutical ingredient
Bendamustine hydrochloride
active pharmaceutical ingredient
Boc-(s)-2-amino-2-(3-bromophenyl)acetic acid
Boc-protected amino acid intermediate
Benzyl 4-(hydroxymethyl)piperidine-1-carboxylate
pharmaceutical intermediate
3-nitro-4-(oxan-4-ylmethylamino)benzenesulfonamide
Pharmaceutical intermediate
Piperazine, 1-[[2-(4-chlorophenyl)-4,4-dimethyl-1-cyclohexen-1-yl]methyl]-
pharmaceutical intermediate for API synthesis
4-[5-[2-[4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoyloxy]ethyl-(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoic acid
RSSXIQCZWSXHBO-UHFFFAOYSA-N
CN1C2=C(C=C(C=C2)N(CCOC(=O)CCCC3=NC4=C(N3C)C=CC(=C4)N(CCCl)CCCl)CCCl)N=C1CCCC(=O)O