4-Methylpiperidine-2,2,6,6-d4 is a deuterium-labeled version of 4-methylpiperidine, where hydrogen atoms at positions 2, 2, 6, and 6 are replaced with deuterium. It is primarily used as a research reagent in studies involving isotopic labeling, such as tracing or analytical chemistry applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-Methylpiperidine-2,2,6,6-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3,5-dibromopyridine-d3
Deuterated research compound
2-Bromobutanoic acid-d6
deuterated research compound
2,3,4,4',5-pentachlorobiphenyl-2',3',5',6'-d4
Isotope-labeled analytical reference standard
4-fluoronitrobenzene-d4
deuterated analytical reference standard
4-Methylpiperidine
chemical intermediate
2,2,6,6-tetradeuterio-4-methylpiperidine
UZOFELREXGAFOI-CQOLUAMGSA-N
[2H]C1(CC(CC(N1)([2H])[2H])C)[2H]
4-Methylpiperidine-2,2,6,6-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.