N-Nitrosodiethylamine-d10 is a deuterated internal standard designed for analytical research applications. It is a labeled analog of N-nitrosodiethylamine, used primarily to ensure accuracy in quantitative analysis through isotope dilution methods.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1219794-54-3
4-N-OCTYL-D17-PHENOL
deuterated research standard
4-N-OCTYL-D17-ANISOLE
deuterated research reference standard
Lignoceric acid-d4-2
Deuterated fatty acid research standard
2,2',4,6,6'-pentachlorobiphenyl-3',4',5'-d3
research compound
N,N-bis(1,1,2,2,2-pentadeuterioethyl)nitrous amide
WBNQDOYYEUMPFS-MWUKXHIBSA-N
[2H]C([2H])([2H])C([2H])([2H])N(C([2H])([2H])C([2H])([2H])[2H])N=O