This compound is a deuterated form of linalool, used primarily as an analytical standard in research and quality control. Its incorporation of three deuterium atoms enables precise quantification and tracing in mass spectrometry and other analytical methods.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(+/-)-linalool-d3 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1-Naphthol-2,3,4,5,6,7,8-d7
deuterated analytical standard
4-Fluoroanisole-2,3,5,6-d4
deuterated analytical standard
Tris(2-ethylhexyl) Phosphate-d51
deuterated analytical standard
(+/-)-Ropivacaine-d7 (propyl-d7)
deuterated analytical standard
2-Chloro-1,3-propanediol-d5 (Major)
Deuterated research compound
Ammoninum-d4 Deuteroxide
deuterated ammonium hydroxide solution
4,6-Dihydroxypyrazolo[3,4-d]pyrimidine-13C,15N2
isotopically labeled research compound
N-Acetyl-4-aminobiphenyl-d5
internal standard for analytical research
1,1,2-trideuterio-3,7-dimethylocta-1,6-dien-3-ol
CDOSHBSSFJOMGT-WSWICNJZSA-N
[2H]C(=C([2H])C(C)(CCC=C(C)C)O)[2H]
(+/-)-linalool-d3 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.