3,4,5-Trifluorobenzoic acid is a fluorinated benzoic acid derivative used as a probe in structural chemistry studies, particularly in examining crystal packing and hydrogen-bonding patterns of benzoic acids. It is a polar aromatic compound with a carboxylic acid group and three fluorine substituents.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 121602-93-5
3,4,5-trifluorobenzoic acid
VJMYKESYFHYUEQ-UHFFFAOYSA-N
C1=C(C=C(C(=C1F)F)F)C(=O)O