DPPF (1,1'-bis(diphenylphosphino)ferrocene) is a research reagent primarily used as an ionophore in chemical sensing applications. Its structure features a ferrocene backbone with two diphenylphosphino groups, enabling selective ion binding and detection.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 12150-46-8
(1,1'-Bis(diphenylphosphino)ferrocene)dichloropalladium
palladium catalyst for cross-coupling reactions
[1,1'-Bis(diphenylphosphino)ferrocene]palladium(II) chloride dichloromethane complex
Cross-coupling catalyst in organic synthesis
(r)-4-(trimethylsilyl)-3-butyn-2-ol
research chemical
Midazolam 2,5-Dioxide-d6
deuterated analytical reference standard
N-Acetyl Sulfamethoxazole-d4 (major)
Research compound for metabolite analysis
Zolpidem-d6 6-Carboxylic Acid Methyl Ester
research compound
bis(cyclopenta-1,4-dien-1-yl(diphenyl)phosphane);iron(2+)
KZPYGQFFRCFCPP-UHFFFAOYSA-N
[CH-]1C=CC(=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.[CH-]1C=CC(=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.[Fe+2]