(4-Pentylphenyl)boronic acid is a boronic acid derivative featuring a pentyl-substituted phenyl ring. It is commonly employed as a research reagent, particularly in organic synthesis and cross-coupling reactions.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(4-pentylphenyl)boronic Acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(4-heptylphenyl)boronic Acid
n.a
4-Butylphenylboronic acid
research chemical and synthetic intermediate
(4-propylphenyl)boronic Acid
Boronic acid reagent for organic synthesis
2,3-Difluorophenylboronic acid
research compound
P-(octyloxyphenyl)phenyliodonium hexafluoroantimonate
photoacid generator for polymerizations
Dplgltaa
fluorogenic substrate for collagenase
Bis[cinnamyl palladium(II) chloride]
organometallic catalyst precursor
(4-pentylphenyl)boronic acid
UZRMPSOGFATLJE-UHFFFAOYSA-N
B(C1=CC=C(C=C1)CCCCC)(O)O
(4-pentylphenyl)boronic Acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.