N3-PEG9-CH2CH2NH2 is a polyethylene glycol (PEG)-based compound featuring an azide group and a terminal amine. As a click chemistry linker, it is primarily used in research settings for bioconjugation and molecular assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
N3-PEG9-CH2CH2NH2 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1-Amino-11-azido-3,6,9-trioxaundecane
PEG linker for bioconjugation
L-Tyrosine, L-cysteinyl-L-cysteinyl-L-alpha-glutamyl-L-tyrosyl-L-cysteinyl-L-cysteinyl-L-alpha-aspartyl-L-prolyl-L-alanyl-L-cysteinyl-L-threonylglycyl-L-cysteinyl-, cyclic (1-->6),(2-->10),(5-->13)-tris(disulfide)
research compound
Dichloro(1,5-cyclooctadiene)platinum(II)
organometallic synthesis and catalysis reagent
2-Bromo-3,6-difluorophenol
research compound
Chloropalladium(1+) 2-methylprop-2-en-1-ide (1/1)
Organometallic catalyst precursor
2-[2-[2-[2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine
QECAUUOGHAUEDJ-UHFFFAOYSA-N
C(COCCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-])N
N3-PEG9-CH2CH2NH2 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.