This compound is a chloroformate derivative of a tetrahydroisoquinoline, characterized by a single chiral center. It is typically used as a research reagent for the synthesis of more complex molecules in medicinal chemistry studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
9-([1,1'-Biphenyl]-4-yl)-10-bromo-2-phenylanthracene
Organic electronic material intermediate
3,4-dihydroisoquinolin-1(2H)-one
research compound
2-chloro-6-(trifluoromethyl)isonicotinonitrile
pharmaceutical intermediate
5'-ODMT cEt N-Bz A Phosphoramidite (Amidite)
DNA oligonucleotide synthesis reagent
Ethyl (1S)-1-phenyl-3,4-dihydroisoquinoline-2(1H)-carboxylate
pharmaceutical intermediate
(1S)-1-phenyl-1,2,3,4-tetrahydroisoquinoline
pharmaceutical intermediate
(1S)-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carbonyl chloride
RRAXMPIDJONJNT-HNNXBMFYSA-N
C1CN([C@H](C2=CC=CC=C21)C3=CC=CC=C3)C(=O)Cl
—
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.