8-Aminonaphthalene-2-sulfonic acid is an organic compound used as an intermediate in the production of azo dyes. It also serves as a reagent for the determination of nitrite formation from nitrate by bacteria.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 119-28-8
5-Amino-2-naphthalenesulfonic acid
dye intermediate
5-Amino-2-naphthalenesulfonic acid
Intermediate for azo dyes
P-Anisidine
azo dye intermediate
4-Methyl-3-nitroaniline
dye intermediate
4-Hydroxy-7-(phenylamino)naphthalene-2-sulfonic acid
dye intermediate for azo dyes
5-Amino-2-[(4-aminophenyl)amino]benzenesulfonic acid
dye intermediate
4-Nitro-4'-aminostilbene-2,2'-disulfonic acid
stilbene dye intermediate
8-aminonaphthalene-2-sulfonic acid
QEZZCWMQXHXAFG-UHFFFAOYSA-N
C1=CC2=C(C=C(C=C2)S(=O)(=O)O)C(=C1)N