Pteroic acid is a chemical compound that serves as a direct precursor in the biosynthesis of folic acid. It consists of a pterin ring system linked to a 4-aminobenzoic acid moiety, containing both aromatic and heterocyclic structures with carboxylic acid and amine functional groups.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 119-24-4
L-Homocitrulline
research compound
N-Acetylcysteamine
research reagent
[(2R)-pyrrolidin-2-yl]methanamine dihydrochloride
research compound
Methyl 6-chloro-2-oxo-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine-4-carboxylate
research compound
Folic acid
Vitamin nutritional factor
Folic acid dihydrate
active pharmaceutical ingredient
N-Nitrosofolic acid
nitrosamine impurity standard for folic acid
N2-(4-(((2-Amino-4-oxo-4,8-dihydropteridin-6-yl)methyl)amino)benzoyl)-N5-(2-(2-(2-azidoethoxy)ethoxy)ethyl)-L-glutamine
PEGylated folate probe for click chemistry
4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoic acid
JOAQINSXLLMRCV-UHFFFAOYSA-N
C1=CC(=CC=C1C(=O)O)NCC2=CN=C3C(=N2)C(=O)NC(=N3)N