This compound is a boron-containing heterocyclic molecule, specifically a benzoxaborole derivative, used as a research reagent in drug discovery. Its structure features an ester and ether linkages along with an aromatic boronic acid ester moiety, contributing to its properties for laboratory studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1,3,5-tri(4-aminophenyl)benzene
Host compound for polynitroaromatic inclusion
2-Fluoro-4-methylbenzyl bromide
chemical synthesis intermediate
2-(1-(ethylsulfonyl)azetidin-3-ylidene)acetonitrile
research chemical
4-(1-(1-ethoxyethyl)-1H-pyrazol-4-yl)-7-((2-(trimethylsilyl)ethoxy)methyl)-7H-pyrrolo[2,3-d]pyrimidine
research compound
Crisaborole
Phosphodiesterase 4 Inhibitor
methyl 4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzoate
PABMLERDCICNNG-UHFFFAOYSA-N
B1(C2=C(CO1)C=C(C=C2)OC3=CC=C(C=C3)C(=O)OC)O
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.