1,4-This compound is a chemical compound used as a pharmaceutical intermediate. It contains ester functional groups and is employed in the synthesis of other compounds for research and manufacturing purposes.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1187-74-2
Tert-butyl N-[5-(trifluoromethyl)pyridin-3-yl]carbamate
pharmaceutical intermediate
Methyl (2S)-2-oxiranecarboxylate
chiral building block for synthesis
(S)-(+)-Glycidyl-4-nitrobenzoate
Chiral building block for synthesis
1,3-Dihydro-1-hydroxy-2,1-benzoxaborol-5-ol
Benzoxaborole pharmaceutical intermediate
diethyl 2-(2-oxopropyl)butanedioate
AAPVOVKOHNCXJA-UHFFFAOYSA-N
CCOC(=O)CC(CC(=O)C)C(=O)OCC