Acetic acid-d4 is a deuterated form of acetic acid where all hydrogen atoms are replaced by deuterium. It is primarily used as a solvent in nuclear magnetic resonance (NMR) spectroscopy due to its minimal interference with proton NMR signals.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Acetic acid-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Methanol-d
NMR solvent
(2H6)Ethanol
NMR solvent
Methylene chloride-D2
NMR solvent
Octadeuterotetrahydrofuran
NMR solvent
N-(5-((4-((4-ethylpiperazin-1-yl)methyl)-3-(trifluoromethyl)phenyl)carbamoyl)-2-methylphenyl)-5-(thiophen-2-yl)pyridine-3-carboxamide (6)
research compound
2-(4-bromophenyl)-5-phenylthiophene
Research reagent for organic synthesis
Butyl (S)-oxirane-2-carboxylate
research compound
5-Chlorobiphenyl-3-ylboronic acid
Suzuki coupling reagent
Acetic acid-d4(CAS 1186-52-3)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
deuterio 2,2,2-trideuterioacetate
QTBSBXVTEAMEQO-GUEYOVJQSA-N
[2H]C([2H])([2H])C(=O)O[2H]
Acetic acid-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.