Acetic acid-d4 is a deuterated form of acetic acid where all hydrogen atoms are replaced by deuterium. It is primarily used as a solvent in nuclear magnetic resonance (NMR) spectroscopy due to its minimal interference with proton NMR signals.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1186-52-3
Methanol-d
NMR solvent
(2H6)Ethanol
NMR solvent
Methylene chloride-D2
NMR solvent
Octadeuterotetrahydrofuran
NMR solvent
N-(5-((4-((4-ethylpiperazin-1-yl)methyl)-3-(trifluoromethyl)phenyl)carbamoyl)-2-methylphenyl)-5-(thiophen-2-yl)pyridine-3-carboxamide (6)
research compound
2-(4-bromophenyl)-5-phenylthiophene
Research reagent for organic synthesis
Butyl (S)-oxirane-2-carboxylate
research compound
5-Chlorobiphenyl-3-ylboronic acid
Suzuki coupling reagent
deuterio 2,2,2-trideuterioacetate
QTBSBXVTEAMEQO-GUEYOVJQSA-N
[2H]C([2H])([2H])C(=O)O[2H]