Hexaphenoxycyclotriphosphazene is an industrial chemical used primarily as a flame retardant additive. It is incorporated into materials such as plastics, textiles, and surface coatings to inhibit or slow the spread of fire through various physical and chemical mechanisms.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1184-10-7
Melamine pyrophosphate
Flame retardant additive
1,2,5,6-Tetrabromocyclooctane
Flame retardant additive
Melamine phosphate
Flame retardant additive
Tris(2,3-dibromopropyl) isocyanurate
Flame retardant additive
Pivalic acid, sodium salt
chemical intermediate for organic synthesis
Methyltrimethoxysilane
Coupling agent and cross-linker
N,N-dimethylanilinium tetrakis(pentafluorophenyl)borate
catalyst reagent for chemical synthesis
Tetraethylurea
Industrial chemical intermediate
2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2lambda5,4lambda5,6lambda5-triphosphacyclohexa-1,3,5-triene
RNFJDJUURJAICM-UHFFFAOYSA-N
C1=CC=C(C=C1)OP2(=NP(=NP(=N2)(OC3=CC=CC=C3)OC4=CC=CC=C4)(OC5=CC=CC=C5)OC6=CC=CC=C6)OC7=CC=CC=C7