Hexaphenoxycyclotriphosphazene is an industrial chemical used primarily as a flame retardant additive. It is incorporated into materials such as plastics, textiles, and surface coatings to inhibit or slow the spread of fire through various physical and chemical mechanisms.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Hexaphenoxycyclotriphosphazene 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Melamine pyrophosphate
Flame retardant additive
1,2,5,6-Tetrabromocyclooctane
Flame retardant additive
Melamine phosphate
Flame retardant additive
Tris(2,3-dibromopropyl) isocyanurate
Flame retardant additive
Pivalic acid, sodium salt
chemical intermediate for organic synthesis
Methyltrimethoxysilane
Coupling agent and cross-linker
N,N-dimethylanilinium tetrakis(pentafluorophenyl)borate
catalyst reagent for chemical synthesis
Tetraethylurea
Industrial chemical intermediate
2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2lambda5,4lambda5,6lambda5-triphosphacyclohexa-1,3,5-triene
RNFJDJUURJAICM-UHFFFAOYSA-N
C1=CC=C(C=C1)OP2(=NP(=NP(=N2)(OC3=CC=CC=C3)OC4=CC=CC=C4)(OC5=CC=CC=C5)OC6=CC=CC=C6)OC7=CC=CC=C7
Hexaphenoxycyclotriphosphazene 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.