This compound is a polychlorinated nitroaniline derivative used as an intermediate in pharmaceutical manufacturing. It features an aromatic ether structure with multiple halogen substituents and an amine group.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-Chloro-5-(2,3-dichlorophenoxy)-2-nitroaniline 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
RU Phosphoramidite
RNA oligonucleotide synthesis building block
(R)-Benzyl (5-oxotetrahydrofuran-3-yl)carbamate
Pharmaceutical intermediate for API synthesis
4-[(3,5-dichlorobenzoyl)amino]-3-hydroxybenzoic acid
pharmaceutical intermediate
(R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-(tert-butoxy)phenyl)propanoic acid
protected amino acid for peptide synthesis
4-chloro-5-(2,3-dichlorophenoxy)-2-nitroaniline
WZFITXMPNXRORE-UHFFFAOYSA-N
C1=CC(=C(C(=C1)Cl)Cl)OC2=C(C=C(C(=C2)N)[N+](=O)[O-])Cl
4-Chloro-5-(2,3-dichlorophenoxy)-2-nitroaniline 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.