Homosalate is a salicylate ester that appears as a viscous, light yellow to slightly tan liquid or oil. It is primarily used as a sunscreen agent in personal care products.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 118-56-9
N-Acetyl-L-glutamic acid
amino acid impurity
Panthenyl ethyl ether acetate
cosmetic ingredient
(3R)-3-Hydroxybutyl (3R)-3-hydroxybutanoate
ketone ester research compound
Roxarsone
veterinary antimicrobial growth promoter
(3,3,5-trimethylcyclohexyl) 2-hydroxybenzoate
WSSJONWNBBTCMG-UHFFFAOYSA-N
CC1CC(CC(C1)(C)C)OC(=O)C2=CC=CC=C2O