This compound is a salt-like organoboron reagent, typically supplied as a research chemical. Its structure features a pyrazole ring and a boronate ester moiety, making it of interest for organic synthesis and materials science studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1173889-20-7
3-amino-3-(3-bromophenyl)propanoic acid
Research compound
3-amino-3-(3-fluorophenyl)propanoic acid
chemical compound for research
1,1-Dimethylethyl 4-[[[(1R,2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]oct-2-yl]carbonyl]amino]-1-piperidinecarboxylate
research compound
5-Bromo-6-methyl-3-pyridinecarboxaldehyde
synthetic building block for pharmaceutical research
lithium 4-(2-hydroxy-4,4,5,5-tetramethyl-1,3-dioxa-2-boranuidacyclopent-2-yl)-1-methylpyrazole
YAGHQCJCHREQHW-UHFFFAOYSA-N
[Li+].[B-]1(OC(C(O1)(C)C)(C)C)(C2=CN(N=C2)C)O
—