4-Bromobenz-2,3,5,6-d4-aldehyde is a deuterated research reagent, specifically the tetradeuterated form of 4-bromobenzaldehyde in which the four aromatic hydrogen atoms are replaced by deuterium. It is primarily used in scientific research where isotopic labeling is required, such as in mechanistic studies or as an internal standard for analytical chemistry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1173020-64-8
4-Amino-3,5-dichloro-alpha-(((1-(methyl-d3)ethyl-1,2,2,2-d4)amino)methyl)benzenemethanol
Deuterated analytical reference standard
Leucomalachite Green-d6
stable isotope labeled reference standard
Tetramisole-d5 hydrochloride
research reagent
1,3-Difluorobenzene-d4
deuterated research compound
4-Bromobenzaldehyde
Pharmaceutical intermediate
4-bromo-2,3,5,6-tetradeuteriobenzaldehyde
ZRYZBQLXDKPBDU-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1C=O)[2H])[2H])Br)[2H]