4-Bromobenz-2,3,5,6-d4-aldehyde is a deuterated research reagent, specifically the tetradeuterated form of 4-bromobenzaldehyde in which the four aromatic hydrogen atoms are replaced by deuterium. It is primarily used in scientific research where isotopic labeling is required, such as in mechanistic studies or as an internal standard for analytical chemistry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-Bromobenz-2,3,5,6-d4-aldehyde 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-Amino-3,5-dichloro-alpha-(((1-(methyl-d3)ethyl-1,2,2,2-d4)amino)methyl)benzenemethanol
Deuterated analytical reference standard
Leucomalachite Green-d6
stable isotope labeled reference standard
Tetramisole-d5 hydrochloride
research reagent
1,3-Difluorobenzene-d4
deuterated research compound
4-Bromobenzaldehyde
Pharmaceutical intermediate
4-bromo-2,3,5,6-tetradeuteriobenzaldehyde
ZRYZBQLXDKPBDU-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1C=O)[2H])[2H])Br)[2H]
4-Bromobenz-2,3,5,6-d4-aldehyde 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.