1-Naphthol-4,8-disulfonic acid is a naphthol disulfonic acid compound used as an intermediate in the synthesis of dyes. Its structure features a naphthalene ring with hydroxyl and two sulfonic acid groups, contributing to its reactivity in dye manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 117-56-6
1-Naphthalenesulfonic acid, 5-hydroxy-
Dye intermediate for azo dyes
Benzidine-2,2'-disulfonic acid
Dye intermediate for azo dyes
2-Amino-1,5-naphthalenedisulfonic acid
dye intermediate
Leucocrystal Violet-d6
Leuco form of crystal violet dye
4-hydroxynaphthalene-1,5-disulfonic acid
XIQKALDENTUXBY-UHFFFAOYSA-N
C1=CC2=C(C=CC(=C2C(=C1)S(=O)(=O)O)O)S(=O)(=O)O