This compound is a research reagent featuring a urea-linked pyrazole structure with tert-butyl, methylphenyl, and pyridin-3-yloxymethyl substituents. It is primarily used in laboratory research as a chemical tool for studying biological or chemical systems.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1166393-85-6
Ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]acetate
boronic ester research compound
6-Chloropyrazolo[1,5-a]pyridine-3-carboxylic acid
research compound
Methyl 4-chloropyrazolo[1,5-a]pyridine-3-carboxylate
research compound
4-Chloropyrazolo[1,5-a]pyridine-3-carboxylic acid
Research reagent for chemical synthesis
1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[5-(pyridin-3-yloxymethyl)-1H-pyrazol-3-yl]urea
NJARPUHZDSAXPL-UHFFFAOYSA-N
CC1=CC=C(C=C1)N2C(=CC(=N2)C(C)(C)C)NC(=O)NC3=NNC(=C3)COC4=CN=CC=C4